Online Database of Chemicals from Around the World
|
CAS#: 87569-96-8 Product: Ethyl 2-(6-ethoxy-3-oxo-3H-xanthen-9-yl)benzoate No suppilers available for the product. |
| Name | Ethyl 2-(6-ethoxy-3-oxo-3H-xanthen-9-yl)benzoate |
|---|---|
| Synonyms | Ethoxyfluorescein ethyl ester; Ethyl 2-(6-ethoxy-3-oxo-3H-xanthen-9-yl)benzoate # |
| Molecular Structure |  |
| Molecular Formula | C24H20O5 |
| Molecular Weight | 388.41 |
| CAS Registry Number | 87569-96-8 |
| SMILES | O=C(OCC)c4ccccc4C=1c3c(OC=2C=1\C=C/C(=O)C=2)cc(OCC)cc3 |
| InChI | 1S/C24H20O5/c1-3-27-16-10-12-20-22(14-16)29-21-13-15(25)9-11-19(21)23(20)17-7-5-6-8-18(17)24(26)28-4-2/h5-14H,3-4H2,1-2H3 |
| InChIKey | FRUHKPFGFOXNQJ-UHFFFAOYSA-N |
| Density | 1.301g/cm3 (Cal.) |
|---|---|
| Boiling point | 605.434°C at 760 mmHg (Cal.) |
| Flash point | 339.166°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-(6-ethoxy-3-oxo-3H-xanthen-9-yl)benzoate |