|
CAS#: 875900-94-0 Product: 2-Methyl-2-propanyl 4-[2-(1H-indol-3-yl)ethyl]-1-piperazinecarboxylate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl 4-[2-(1H-indol-3-yl)ethyl]-1-piperazinecarboxylate |
|---|---|
| Synonyms | 1-Boc-4-[2-(1H-Indol-3-yl)-ethyl]-piperazine; 4-[2-(1H- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 |
| CAS Registry Number | 875900-94-0 |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CCc2c[nH]c3c2cccc3 |
| InChI | 1S/C19H27N3O2/c1-19(2,3)24-18(23)22-12-10-21(11-13-22)9-8-15-14-20-17-7-5-4-6-16(15)17/h4-7,14,20H,8-13H2,1-3H3 |
| InChIKey | FKCFYGHUOXZTAQ-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.588°C at 760 mmHg (Cal.) |
| Flash point | 243.242°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl 4-[2-(1H-indol-3-yl)ethyl]-1-piperazinecarboxylate |