|
CAS#: 87615-44-9 Product: 6-Amino-1,3-Dihydroxybenzocycloheptene No suppilers available for the product. |
| Name | 6-Amino-1,3-Dihydroxybenzocycloheptene |
|---|---|
| Synonyms | 6-Adbch; 6-amino-1,3-dihydroxybenzocycloheptene |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 |
| CAS Registry Number | 87615-44-9 |
| SMILES | O/C1=C/C2/C=C(\C=C/C=C2/C(/O)=C1)N |
| InChI | 1S/C11H11NO2/c12-8-2-1-3-10-7(4-8)5-9(13)6-11(10)14/h1-7,13-14H,12H2 |
| InChIKey | AGQYKUYYRZPUPI-UHFFFAOYSA-N |
| Density | 1.367g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.832°C at 760 mmHg (Cal.) |
| Flash point | 243.994°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Amino-1,3-Dihydroxybenzocycloheptene |