|
CAS#: 87641-23-4 Product: 1-[(3R,3aS,5R,7aR)-1,1,3-Trimethyloctahydro-1H-inden-5-yl]acetone No suppilers available for the product. |
| Name | 1-[(3R,3aS,5R,7aR)-1,1,3-Trimethyloctahydro-1H-inden-5-yl]acetone |
|---|---|
| Synonyms | 4(5)-Acetyl-7,7,9(7,9,9)-trimethylbicyclonon-1-ene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 |
| CAS Registry Number | 87641-23-4 |
| SMILES | O=C(C)C[C@H]1C[C@H]2[C@@H](CC([C@@H]2CC1)(C)C)C |
| InChI | 1S/C15H26O/c1-10-9-15(3,4)14-6-5-12(7-11(2)16)8-13(10)14/h10,12-14H,5-9H2,1-4H3/t10-,12+,13+,14-/m1/s1 |
| InChIKey | YMCULJCILXEENE-VZZFWQQMSA-N |
| Density | 0.888g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.995°C at 760 mmHg (Cal.) |
| Flash point | 101.174°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(3R,3aS,5R,7aR)-1,1,3-Trimethyloctahydro-1H-inden-5-yl]acetone |