|
CAS#: 87668-74-4 Product: (2R)-2-[(1R)-1-(4-Amino-2-oxo-1(2H)-pyrimidinyl)-2-oxoethoxy]-3-oxopropyl trihydrogen diphosphate No suppilers available for the product. |
| Name | (2R)-2-[(1R)-1-(4-Amino-2-oxo-1(2H)-pyrimidinyl)-2-oxoethoxy]-3-oxopropyl trihydrogen diphosphate |
|---|---|
| Synonyms | Cdp 2',3'-dialdehyde; Cytidine 5'-diphosphate 2',3'-dialdehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13N3O11P2 |
| Molecular Weight | 401.16 |
| CAS Registry Number | 87668-74-4 |
| SMILES | O=C1/N=C(\C=C/N1[C@H](O[C@@H](C=O)COP(=O)(O)OP(=O)(O)O)C=O)N |
| InChI | 1S/C9H13N3O11P2/c10-7-1-2-12(9(15)11-7)8(4-14)22-6(3-13)5-21-25(19,20)23-24(16,17)18/h1-4,6,8H,5H2,(H,19,20)(H2,10,11,15)(H2,16,17,18)/t6-,8+/m0/s1 |
| InChIKey | XKNZZWKZFGFISK-POYBYMJQSA-N |
| Density | 2.007g/cm3 (Cal.) |
|---|---|
| Boiling point | 665.037°C at 760 mmHg (Cal.) |
| Flash point | 356.002°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-2-[(1R)-1-(4-Amino-2-oxo-1(2H)-pyrimidinyl)-2-oxoethoxy]-3-oxopropyl trihydrogen diphosphate |