|
CAS#: 87686-36-0 Product: 4-[(2,4-Dimethylphenyl)amino]-1-methyl-1,2-dihydro-6H-pyrazolo[3,4-d]pyrimidin-6-one No suppilers available for the product. |
| Name | 4-[(2,4-Dimethylphenyl)amino]-1-methyl-1,2-dihydro-6H-pyrazolo[3,4-d]pyrimidin-6-one |
|---|---|
| Synonyms | 4-[(2,4-D |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.30 |
| CAS Registry Number | 87686-36-0 |
| SMILES | O=C/1/N=C(\C2=C\NN(/C2=N\1)C)Nc3ccc(cc3C)C |
| InChI | 1S/C14H15N5O/c1-8-4-5-11(9(2)6-8)16-12-10-7-15-19(3)13(10)18-14(20)17-12/h4-7,15H,1-3H3,(H,16,17,20) |
| InChIKey | NSDHFFMLENNTQE-UHFFFAOYSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.231°C at 760 mmHg (Cal.) |
| Flash point | 203.11°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(2,4-Dimethylphenyl)amino]-1-methyl-1,2-dihydro-6H-pyrazolo[3,4-d]pyrimidin-6-one |