|
CAS#: 87764-13-4 Product: 2-{[(1S,4aS,8aR)-1,2,4a-Trimethyl-5-methylenedecahydro-1-naphthalenyl]methyl}-1,4-benzenediol No suppilers available for the product. |
| Name | 2-{[(1S,4aS,8aR)-1,2,4a-Trimethyl-5-methylenedecahydro-1-naphthalenyl]methyl}-1,4-benzenediol |
|---|---|
| Synonyms | arenarol; NSC613793 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.46 |
| CAS Registry Number | 87764-13-4 |
| SMILES | Oc1cc(c(O)cc1)C[C@@]3([C@H]2CCC/C(=C)[C@]2(CCC3C)C)C |
| InChI | 1S/C21H30O2/c1-14-6-5-7-19-20(14,3)11-10-15(2)21(19,4)13-16-12-17(22)8-9-18(16)23/h8-9,12,15,19,22-23H,1,5-7,10-11,13H2,2-4H3/t15?,19-,20+,21-/m0/s1 |
| InChIKey | FBMAHDGTCDISLJ-WMKHZRKJSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.055°C at 760 mmHg (Cal.) |
| Flash point | 200.301°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-{[(1S,4aS,8aR)-1,2,4a-Trimethyl-5-methylenedecahydro-1-naphthalenyl]methyl}-1,4-benzenediol |