|
CAS#: 87798-89-8 Product: 1-{3-[4-(2-Chlorophenyl)-1-piperazinyl]propyl}-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione dihydrochloride No suppilers available for the product. |
| Name | 1-{3-[4-(2-Chlorophenyl)-1-piperazinyl]propyl}-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione dihydrochloride |
|---|---|
| Synonyms | 1-(3-(4-( |
| Molecular Structure | ![]() |
| Molecular Formula | C20H27Cl3N6O2 |
| Molecular Weight | 489.83 |
| CAS Registry Number | 87798-89-8 |
| SMILES | Cl.Cl.Clc4ccccc4N3CCN(CCCN2C(=O)c1n(cnc1N(C2=O)C)C)CC3 |
| InChI | 1S/C20H25ClN6O2.2ClH/c1-23-14-22-18-17(23)19(28)27(20(29)24(18)2)9-5-8-25-10-12-26(13-11-25)16-7-4-3-6-15(16)21;;/h3-4,6-7,14H,5,8-13H2,1-2H3;2*1H |
| InChIKey | GKTIOTFRRRKDCT-UHFFFAOYSA-N |
| Boiling point | 637.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 339.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{3-[4-(2-Chlorophenyl)-1-piperazinyl]propyl}-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione dihydrochloride |