Online Database of Chemicals from Around the World
|
CAS#: 87849-05-6 Product: Methyl (2E)-3-{6-[1-hydroxy-1-(4-methylphenyl)-3-(1-pyrrolidinyl)propyl]-2-pyridinyl}acrylate No suppilers available for the product. |
| Name | Methyl (2E)-3-{6-[1-hydroxy-1-(4-methylphenyl)-3-(1-pyrrolidinyl)propyl]-2-pyridinyl}acrylate |
|---|---|
| Synonyms | methyl (E |
| Molecular Structure | ![CAS#: 87849-05-6, Methyl (2E)-3-{6-[1-hydroxy-1-(4-methylphenyl)-3-(1-pyrrolidinyl)propyl]-2-pyridinyl}acrylate](/moreStructures/87849-05-6.gif) |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.48 |
| CAS Registry Number | 87849-05-6 |
| EINECS | 289-353-1 |
| SMILES | O=C(OC)\C=C\c1nc(ccc1)C(O)(c2ccc(cc2)C)CCN3CCCC3 |
| InChI | 1S/C23H28N2O3/c1-18-8-10-19(11-9-18)23(27,14-17-25-15-3-4-16-25)21-7-5-6-20(24-21)12-13-22(26)28-2/h5-13,27H,3-4,14-17H2,1-2H3/b13-12+ |
| InChIKey | ZRPSDVVHVWUPEC-OUKQBFOZSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 574.543°C at 760 mmHg (Cal.) |
| Flash point | 301.273°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2E)-3-{6-[1-hydroxy-1-(4-methylphenyl)-3-(1-pyrrolidinyl)propyl]-2-pyridinyl}acrylate |