|
CAS#: 87994-68-1 Product: 19-Aminoandrost-4-ene-3,17-dione No suppilers available for the product. |
| Name | 19-Aminoandrost-4-ene-3,17-dione |
|---|---|
| Synonyms | 19-Aado; 19-amino-4-androstene-3,17-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.42 |
| CAS Registry Number | 87994-68-1 |
| SMILES | O=C4/C=C3/CC[C@@H]2[C@H](CC[C@@]1(C(=O)CC[C@H]12)C)[C@@]3(CN)CC4 |
| InChI | 1S/C19H27NO2/c1-18-8-7-16-14(15(18)4-5-17(18)22)3-2-12-10-13(21)6-9-19(12,16)11-20/h10,14-16H,2-9,11,20H2,1H3/t14-,15-,16-,18-,19+/m0/s1 |
| InChIKey | WNNJNJHARHJMJK-BGJMDTOESA-N |
| Density | 1.162g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.572°C at 760 mmHg (Cal.) |
| Flash point | 238.998°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 19-Aminoandrost-4-ene-3,17-dione |