|
CAS#: 88025-93-8 Product: Methyl [4-({4-[(diaminomethylene)amino]benzyl}oxy)-2-(dimethylcarbamoyl)phenyl]acetate sulfate (1:1) No suppilers available for the product. |
| Name | Methyl [4-({4-[(diaminomethylene)amino]benzyl}oxy)-2-(dimethylcarbamoyl)phenyl]acetate sulfate (1:1) |
|---|---|
| Synonyms | DGPM; N,N-Dgpm |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26N4O8S |
| Molecular Weight | 482.51 |
| CAS Registry Number | 88025-93-8 |
| SMILES | O=S(=O)(O)O.O=C(c2cc(OCc1ccc(/N=C(\N)N)cc1)ccc2CC(=O)OC)N(C)C |
| InChI | 1S/C20H24N4O4.H2O4S/c1-24(2)19(26)17-11-16(9-6-14(17)10-18(25)27-3)28-12-13-4-7-15(8-5-13)23-20(21)22;1-5(2,3)4/h4-9,11H,10,12H2,1-3H3,(H4,21,22,23);(H2,1,2,3,4) |
| InChIKey | DEKMKBJBARFDEZ-UHFFFAOYSA-N |
| Boiling point | 620.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 329°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl [4-({4-[(diaminomethylene)amino]benzyl}oxy)-2-(dimethylcarbamoyl)phenyl]acetate sulfate (1:1) |