|
CAS#: 88090-55-5 Product: L-Alanyl-L-alanyl-3-({2-[(2,6-dicarboxy-4-pyridinyl)amino]ethyl}disulfanyl)-L-alanine No suppilers available for the product. |
| Name | L-Alanyl-L-alanyl-3-({2-[(2,6-dicarboxy-4-pyridinyl)amino]ethyl}disulfanyl)-L-alanine |
|---|---|
| Synonyms | Ala-ala-cys-mepda; Alanylala |
| Molecular Structure | ![]() |
| Molecular Formula | C18H25N5O8S2 |
| Molecular Weight | 503.55 |
| CAS Registry Number | 88090-55-5 |
| SMILES | O=C(O)c1nc(cc(NCCSSC[C@@H](C(=O)O)NC(=O)[C@@H](NC(=O)[C@@H](N)C)C)c1)C(=O)O |
| InChI | 1S/C18H25N5O8S2/c1-8(19)14(24)21-9(2)15(25)23-13(18(30)31)7-33-32-4-3-20-10-5-11(16(26)27)22-12(6-10)17(28)29/h5-6,8-9,13H,3-4,7,19H2,1-2H3,(H,20,22)(H,21,24)(H,23,25)(H,26,27)(H,28,29)(H,30,31)/t8-,9-,13-/m0/s1 |
| InChIKey | XVIVGEVJDSWUPH-RVBZMBCESA-N |
| Density | 1.519g/cm3 (Cal.) |
|---|---|
| Boiling point | 961.262°C at 760 mmHg (Cal.) |
| Flash point | 535.152°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Alanyl-L-alanyl-3-({2-[(2,6-dicarboxy-4-pyridinyl)amino]ethyl}disulfanyl)-L-alanine |