|
CAS#: 88108-86-5 Product: (1,3-Dioxo-1,3,4,5,6,7-hexahydro-2H-isoindol-2-yl)methyl 2',2',3,3-tetramethyl-1,1'-bi(cyclopropyl)-2-carboxylate No suppilers available for the product. |
| Name | (1,3-Dioxo-1,3,4,5,6,7-hexahydro-2H-isoindol-2-yl)methyl 2',2',3,3-tetramethyl-1,1'-bi(cyclopropyl)-2-carboxylate |
|---|---|
| Synonyms | 2,2-Dimet |
| Molecular Structure | ![]() |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.43 |
| CAS Registry Number | 88108-86-5 |
| SMILES | O=C1\C4=C(/C(=O)N1COC(=O)C3C(C2CC2(C)C)C3(C)C)CCCC4 |
| InChI | 1S/C20H27NO4/c1-19(2)9-13(19)14-15(20(14,3)4)18(24)25-10-21-16(22)11-7-5-6-8-12(11)17(21)23/h13-15H,5-10H2,1-4H3 |
| InChIKey | WLQIMPYJCOSFHO-UHFFFAOYSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.096°C at 760 mmHg (Cal.) |
| Flash point | 230.848°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1,3-Dioxo-1,3,4,5,6,7-hexahydro-2H-isoindol-2-yl)methyl 2',2',3,3-tetramethyl-1,1'-bi(cyclopropyl)-2-carboxylate |