|
CAS#: 88153-50-8 Product: 4-(2,5-Dihydroxyphenyl)-5-hydroxy-7-methoxy-2H-chromen-2-one No suppilers available for the product. |
| Name | 4-(2,5-Dihydroxyphenyl)-5-hydroxy-7-methoxy-2H-chromen-2-one |
|---|---|
| Synonyms | 4-(2,5-dihydroxyphenyl)-5-hydroxy-7-methoxy-2-benzopyrone; NSC371093 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 |
| CAS Registry Number | 88153-50-8 |
| EINECS | 289-391-9 |
| SMILES | O=C/2Oc1cc(OC)cc(O)c1\C(=C\2)c3cc(O)ccc3O |
| InChI | 1S/C16H12O6/c1-21-9-5-13(19)16-11(7-15(20)22-14(16)6-9)10-4-8(17)2-3-12(10)18/h2-7,17-19H,1H3 |
| InChIKey | SLKYVJWZJRRXFL-UHFFFAOYSA-N |
| Density | 1.512g/cm3 (Cal.) |
|---|---|
| Boiling point | 613.822°C at 760 mmHg (Cal.) |
| Flash point | 234.955°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,5-Dihydroxyphenyl)-5-hydroxy-7-methoxy-2H-chromen-2-one |