|
CAS#: 88247-59-0 Product: 2-{4-[(4-Isopropylphenyl)(1,2-thiazol-5-yl)methyl]-1-piperazinyl}ethanol dihydrochloride No suppilers available for the product. |
| Name | 2-{4-[(4-Isopropylphenyl)(1,2-thiazol-5-yl)methyl]-1-piperazinyl}ethanol dihydrochloride |
|---|---|
| Synonyms | M&B 30227; M&B-30227 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H29Cl2N3OS |
| Molecular Weight | 418.42 |
| CAS Registry Number | 88247-59-0 |
| SMILES | Cl.Cl.OCCN3CCN(C(c1sncc1)c2ccc(cc2)C(C)C)CC3 |
| InChI | 1S/C19H27N3OS.2ClH/c1-15(2)16-3-5-17(6-4-16)19(18-7-8-20-24-18)22-11-9-21(10-12-22)13-14-23;;/h3-8,15,19,23H,9-14H2,1-2H3;2*1H |
| InChIKey | FVWKNWYUWBILNF-UHFFFAOYSA-N |
| Boiling point | 427.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 212.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-{4-[(4-Isopropylphenyl)(1,2-thiazol-5-yl)methyl]-1-piperazinyl}ethanol dihydrochloride |