Online Database of Chemicals from Around the World
|
CAS#: 88321-10-2 Product: 2,3-Dihydroxy-2-methylpropyl 4-(4-amino-6,7,8-trimethoxy-2-quinazolinyl)-1-piperazinecarboxylate No suppilers available for the product. |
| Name | 2,3-Dihydroxy-2-methylpropyl 4-(4-amino-6,7,8-trimethoxy-2-quinazolinyl)-1-piperazinecarboxylate |
|---|---|
| Synonyms | 1-Hydroxytrimazosin; 2-Hydroxy |
| Molecular Structure |  |
| Molecular Formula | C20H29N5O7 |
| Molecular Weight | 451.47 |
| CAS Registry Number | 88321-10-2 |
| SMILES | O=C(OCC(O)(C)CO)N3CCN(c1nc(N)c2c(n1)c(OC)c(OC)c(OC)c2)CC3 |
| InChI | 1S/C20H29N5O7/c1-20(28,10-26)11-32-19(27)25-7-5-24(6-8-25)18-22-14-12(17(21)23-18)9-13(29-2)15(30-3)16(14)31-4/h9,26,28H,5-8,10-11H2,1-4H3,(H2,21,22,23) |
| InChIKey | VEBRPYJKGGXNTN-UHFFFAOYSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 721.664°C at 760 mmHg (Cal.) |
| Flash point | 390.248°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydroxy-2-methylpropyl 4-(4-amino-6,7,8-trimethoxy-2-quinazolinyl)-1-piperazinecarboxylate |