|
CAS#: 88351-63-7 Product: Methyl N-(3-acetamidophenyl)-N-ethyl-beta-alaninate No suppilers available for the product. |
| Name | Methyl N-(3-acetamidophenyl)-N-ethyl-beta-alaninate |
|---|---|
| Synonyms | methyl N-[3-(acetylamino)phenyl]-N-ethyl-β-alaninate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 88351-63-7 |
| EINECS | 289-409-5 |
| SMILES | CC(=O)Nc1cccc(c1)N(CCC(=O)OC)CC |
| InChI | 1S/C14H20N2O3/c1-4-16(9-8-14(18)19-3)13-7-5-6-12(10-13)15-11(2)17/h5-7,10H,4,8-9H2,1-3H3,(H,15,17) |
| InChIKey | AOEBDRLRNJNHSY-UHFFFAOYSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.308°C at 760 mmHg (Cal.) |
| Flash point | 232.186°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl N-(3-acetamidophenyl)-N-ethyl-beta-alaninate |