|
CAS#: 88382-41-6 Product: Ethyl 2,2-difluoro-3,3-bis(trifluoromethyl)cyclopropanecarboxylate No suppilers available for the product. |
| Name | Ethyl 2,2-difluoro-3,3-bis(trifluoromethyl)cyclopropanecarboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H6F8O2 |
| Molecular Weight | 286.12 |
| CAS Registry Number | 88382-41-6 |
| SMILES | FC(F)(F)C1(C(C(=O)OCC)C1(F)F)C(F)(F)F |
| InChI | 1S/C8H6F8O2/c1-2-18-4(17)3-5(6(3,9)10,7(11,12)13)8(14,15)16/h3H,2H2,1H3 |
| InChIKey | FZMMQDZTJIIXTJ-UHFFFAOYSA-N |
| Density | 1.511g/cm3 (Cal.) |
|---|---|
| Boiling point | 130.531°C at 760 mmHg (Cal.) |
| Flash point | 32.715°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2,2-difluoro-3,3-bis(trifluoromethyl)cyclopropanecarboxylate |