|
CAS#: 88412-94-6 Product: N-[4-(9-Acridinylamino)-3-(dimethylamino)phenyl]methanesulfonamide No suppilers available for the product. |
| Name | N-[4-(9-Acridinylamino)-3-(dimethylamino)phenyl]methanesulfonamide |
|---|---|
| Synonyms | Methanesu |
| Molecular Structure | ![]() |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.50 |
| CAS Registry Number | 88412-94-6 |
| SMILES | CN(C)C1=C(C=CC(=C1)NS(=O)(=O)C)NC2=C3C=CC=CC3=NC4=CC=CC=C42 |
| InChI | 1S/C22H22N4O2S/c1-26(2)21-14-15(25-29(3,27)28)12-13-20(21)24-22-16-8-4-6-10-18(16)23-19-11-7-5-9-17(19)22/h4-14,25H,1-3H3,(H,23,24) |
| InChIKey | JCZWUYIXVYHWDE-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 572.0±60.0°C at 760 mmHg (Cal.) |
| Flash point | 299.7±32.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(9-Acridinylamino)-3-(dimethylamino)phenyl]methanesulfonamide |