|
CAS#: 884500-84-9 Product: 2-(5-Hydroxy-2-pyridinyl)-4H-chromen-4-one No suppilers available for the product. |
| Name | 2-(5-Hydroxy-2-pyridinyl)-4H-chromen-4-one |
|---|---|
| Synonyms | 2-(5-Hydroxy-pyridin-2-yl)-chromen-4-one |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.23 |
| CAS Registry Number | 884500-84-9 |
| SMILES | O=C\1c3c(O/C(=C/1)c2ncc(O)cc2)cccc3 |
| InChI | 1S/C14H9NO3/c16-9-5-6-11(15-8-9)14-7-12(17)10-3-1-2-4-13(10)18-14/h1-8,16H |
| InChIKey | NCSGHKVBYGSOQC-UHFFFAOYSA-N |
| Density | 1.4g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.991°C at 760 mmHg (Cal.) |
| Flash point | 271.91°C (Cal.) |
| Refractive index | 1.674 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(5-Hydroxy-2-pyridinyl)-4H-chromen-4-one |