|
CAS#: 885266-93-3 Product: 2,5-Bis-(Difluoromethoxy)-Bromobenzene No suppilers available for the product. |
| Name | 2,5-Bis-(Difluoromethoxy)-Bromobenzene |
|---|---|
| Synonyms | Fs000743 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5BrF4O2 |
| Molecular Weight | 289.02 |
| CAS Registry Number | 885266-93-3 |
| SMILES | C1=C(OC(F)F)C=CC(=C1Br)OC(F)F |
| InChI | 1S/C8H5BrF4O2/c9-5-3-4(14-7(10)11)1-2-6(5)15-8(12)13/h1-3,7-8H |
| InChIKey | WBGSQJVTOARKSH-UHFFFAOYSA-N |
| Density | 1.641g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.448°C at 760 mmHg (Cal.) |
| Flash point | 122.959°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Bis-(Difluoromethoxy)-Bromobenzene |