|
CAS#: 885269-61-4 Product: 4-Amino-6-chloro-2H-chromen-2-one No suppilers available for the product. |
| Name | 4-Amino-6-chloro-2H-chromen-2-one |
|---|---|
| Synonyms | 2H-1-Benzopyran-2-one, 4-amino-6-chloro-; 2H-1-BENZOPYRAN-2-ONE,4-AMINO-6-CHLORO-; 4-Amino-6-chlor-2H-chromen-2-on |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.60 |
| CAS Registry Number | 885269-61-4 |
| SMILES | c1cc2c(cc1Cl)c(cc(=O)o2)N |
| InChI | 1S/C9H6ClNO2/c10-5-1-2-8-6(3-5)7(11)4-9(12)13-8/h1-4H,11H2 |
| InChIKey | JBJOPQHVOOSYPS-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.3±42.0°C at 760 mmHg (Cal.) |
| Flash point | 183.2±27.9°C (Cal.) |
| Refractive index | 1.635 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-6-chloro-2H-chromen-2-one |