|
CAS#: 885269-92-1 Product: 5-(4-Methylphenyl)-3-(2-thienyl)-4,5-dihydro-1H-pyrazole-1-carboxamide No suppilers available for the product. |
| Name | 5-(4-Methylphenyl)-3-(2-thienyl)-4,5-dihydro-1H-pyrazole-1-carboxamide |
|---|---|
| Synonyms | 3-(Thioph |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.36 |
| CAS Registry Number | 885269-92-1 |
| SMILES | CC1=CC=C(C=C1)C2CC(=NN2C(=O)N)C3=CC=CS3 |
| InChI | 1S/C15H15N3OS/c1-10-4-6-11(7-5-10)13-9-12(14-3-2-8-20-14)17-18(13)15(16)19/h2-8,13H,9H2,1H3,(H2,16,19) |
| InChIKey | OXTSXLWTIOELBD-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.7±55.0°C at 760 mmHg (Cal.) |
| Flash point | 236.6±31.5°C (Cal.) |
| Refractive index | 1.695 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(4-Methylphenyl)-3-(2-thienyl)-4,5-dihydro-1H-pyrazole-1-carboxamide |