|
CAS#: 88527-18-8 Product: 8,11-Dimethyl-1,12-dihydropyrano[3,2-a]xanthene-1,5,6,9,10,12-hexol No suppilers available for the product. |
| Name | 8,11-Dimethyl-1,12-dihydropyrano[3,2-a]xanthene-1,5,6,9,10,12-hexol |
|---|---|
| Synonyms | Mycoversilin |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O8 |
| Molecular Weight | 360.32 |
| CAS Registry Number | 88527-18-8 |
| SMILES | O1\C=C/C(O)c4c1c(O)c(O)c3Oc2c(c(O)c(O)c(c2C(O)c34)C)C |
| InChI | 1S/C18H16O8/c1-5-8-13(22)10-9-7(19)3-4-25-17(9)14(23)15(24)18(10)26-16(8)6(2)12(21)11(5)20/h3-4,7,13,19-24H,1-2H3 |
| InChIKey | CFHASEWULLWTPB-UHFFFAOYSA-N |
| Density | 1.728g/cm3 (Cal.) |
|---|---|
| Boiling point | 646.122°C at 760 mmHg (Cal.) |
| Flash point | 344.563°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8,11-Dimethyl-1,12-dihydropyrano[3,2-a]xanthene-1,5,6,9,10,12-hexol |