Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 2-(1,3-Benzodioxol-5-yl)-1,3-oxazole-4-carbaldehyde |
|---|---|
| Synonyms | 2-(1,3-Benzodioxol-5-yl)-1,3-oxazol-4-carbaldehyd; 2-(1,3-Benzodioxol-5-yl)-1,3-oxazole-4-carbaldehyde; 2-(1,3-Benzodioxol-5-yl)-1,3-oxazole-4-carbaldéhyde |
| Molecular Structure |  |
| Molecular Formula | C11H7NO4 |
| Molecular Weight | 217.18 |
| CAS Registry Number | 885273-46-1 |
| SMILES | c1cc2c(cc1c3nc(co3)C=O)OCO2 |
| InChI | 1S/C11H7NO4/c13-4-8-5-14-11(12-8)7-1-2-9-10(3-7)16-6-15-9/h1-5H,6H2 |
| InChIKey | LKKAPSMWLSOIEN-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.7±52.0°C at 760 mmHg (Cal.) |
| Flash point | 190.7±30.7°C (Cal.) |
| Refractive index | 1.623 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1,3-Benzodioxol-5-yl)-1,3-oxazole-4-carbaldehyde |