Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 2-(2-Aminophenyl)-1,3-oxazole-4-carbaldehyde |
|---|---|
| Synonyms | 2-(2-Aminophenyl)-1,3-oxazol-4-carbaldehyd; 2-(2-Aminophenyl)-1,3-oxazole-4-carbaldehyde; 2-(2-Aminophényl)-1,3-oxazole-4-carbaldéhyde |
| Molecular Structure |  |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18 |
| CAS Registry Number | 885274-52-2 |
| SMILES | c1ccc(c(c1)c2nc(co2)C=O)N |
| InChI | 1S/C10H8N2O2/c11-9-4-2-1-3-8(9)10-12-7(5-13)6-14-10/h1-6H,11H2 |
| InChIKey | YLSHXAYLBUAOHB-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.7±48.0°C at 760 mmHg (Cal.) |
| Flash point | 193.1±29.6°C (Cal.) |
| Refractive index | 1.642 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Aminophenyl)-1,3-oxazole-4-carbaldehyde |