Online Database of Chemicals from Around the World
|
CAS#: 88552-00-5 Product: (4Z)-1,1,2,2-Tetrafluoro-5-sulfanyl-4-nonen-3-one No suppilers available for the product. |
| Name | (4Z)-1,1,2,2-Tetrafluoro-5-sulfanyl-4-nonen-3-one |
|---|---|
| Synonyms | 3-Nonene-5-thione, 1,1,2,2-tetrafluoro-3-hydroxy-; 3-Nonene-5-thione,1,1,2,2-tetrafluoro-3-hydroxy- |
| Molecular Structure |  |
| Molecular Formula | C9H12F4OS |
| Molecular Weight | 244.25 |
| CAS Registry Number | 88552-00-5 |
| SMILES | O=C(\C=C(/S)CCCC)C(F)(F)C(F)F |
| InChI | 1S/C9H12F4OS/c1-2-3-4-6(15)5-7(14)9(12,13)8(10)11/h5,8,15H,2-4H2,1H3/b6-5- |
| InChIKey | MNHDCVLGHNJPRI-WAYWQWQTSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 231.914°C at 760 mmHg (Cal.) |
| Flash point | 94.059°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4Z)-1,1,2,2-Tetrafluoro-5-sulfanyl-4-nonen-3-one |