|
CAS#: 88612-90-2 Product: Ethyl 2-(4-nitrophenyl)cyclopropanecarboxylate No suppilers available for the product. |
| Name | Ethyl 2-(4-nitrophenyl)cyclopropanecarboxylate |
|---|---|
| Synonyms | ethyl 2-(4-nitrophenyl)cyclopropanecarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 |
| CAS Registry Number | 88612-90-2 |
| SMILES | [O-][N+](=O)c1ccc(cc1)C2CC2C(=O)OCC |
| InChI | 1S/C12H13NO4/c1-2-17-12(14)11-7-10(11)8-3-5-9(6-4-8)13(15)16/h3-6,10-11H,2,7H2,1H3 |
| InChIKey | MZTNKLFZFLDHMS-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.647°C at 760 mmHg (Cal.) |
| Flash point | 151.932°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-(4-nitrophenyl)cyclopropanecarboxylate |