|
CAS#: 887114-51-4 Product: 1-(4-Fluorobenzyl)-5-nitro-1H-indazole No suppilers available for the product. |
| Name | 1-(4-Fluorobenzyl)-5-nitro-1H-indazole |
|---|---|
| Synonyms | 1-(4-Fluorbenzyl)-5-nitro-1H-indazol; 1-(4-Fluorobenzyl)-5-nitro-1H-indazole; 1-(4-Fluorobenzyl)-5-nitro-1H-indazole |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10FN3O2 |
| Molecular Weight | 271.25 |
| CAS Registry Number | 887114-51-4 |
| SMILES | c1cc(ccc1Cn2c3ccc(cc3cn2)[N+](=O)[O-])F |
| InChI | 1S/C14H10FN3O2/c15-12-3-1-10(2-4-12)9-17-14-6-5-13(18(19)20)7-11(14)8-16-17/h1-8H,9H2 |
| InChIKey | XZTQOLZBKIYIQF-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.2±30.0°C at 760 mmHg (Cal.) |
| Flash point | 229.1±24.6°C (Cal.) |
| Refractive index | 1.654 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Fluorobenzyl)-5-nitro-1H-indazole |