Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Beta Pharma Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (203) 315-5062 / (877) 786-1922 | |||
|
sales@betapharma.com, | |||
| Chemical manufacturer | ||||
| Name | 1-{4-[3-(Trifluoromethoxy)phenoxy]phenyl}ethanone |
|---|---|
| Synonyms | 1-[4-(3-TRIFLUOROMETHOXY-PHENOXY)-PHENYL]-ETHANONE; 1-{4-[3-(Trifluormethoxy)phenoxy]phenyl}ethanon; 1-{4-[3-(Trifluoromethoxy)phenoxy]phenyl}ethanone |
| Molecular Structure | ![CAS#: 887575-19-1, 1-{4-[3-(Trifluoromethoxy)phenoxy]phenyl}ethanone](/moreStructures/887575-19-1.gif) |
| Molecular Formula | C15H11F3O3 |
| Molecular Weight | 296.24 |
| CAS Registry Number | 887575-19-1 |
| SMILES | CC(=O)c1ccc(cc1)Oc2cccc(c2)OC(F)(F)F |
| InChI | 1S/C15H11F3O3/c1-10(19)11-5-7-12(8-6-11)20-13-3-2-4-14(9-13)21-15(16,17)18/h2-9H,1H3 |
| InChIKey | HIOWQDWOBONDRI-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.0±42.0°C at 760 mmHg (Cal.) |
| Flash point | 153.6±22.8°C (Cal.) |
| Refractive index | 1.514 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{4-[3-(Trifluoromethoxy)phenoxy]phenyl}ethanone |