Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3-Amino-3-[3-(methoxymethoxy)phenyl]propanoic acid |
|---|---|
| Synonyms | 3-AMINO-3-(3-METHOXYMETHOXY-PHENYL)-PROPIONICACID; 3-Amino-3-[3-(methoxymethoxy)phenyl]propanoic acid; 3-Amino-3-[3-(methoxymethoxy)phenyl]propansäure |
| Molecular Structure | ![CAS#: 887583-86-0, 3-Amino-3-[3-(methoxymethoxy)phenyl]propanoic acid](/moreStructures/887583-86-0.gif) |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 |
| CAS Registry Number | 887583-86-0 |
| SMILES | COCOc1cccc(c1)C(CC(=O)O)N |
| InChI | 1S/C11H15NO4/c1-15-7-16-9-4-2-3-8(5-9)10(12)6-11(13)14/h2-5,10H,6-7,12H2,1H3,(H,13,14) |
| InChIKey | PUNQTUQIUFKRBE-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.1±42.0°C at 760 mmHg (Cal.) |
| Flash point | 187.9±27.9°C (Cal.) |
| Refractive index | 1.547 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-3-[3-(methoxymethoxy)phenyl]propanoic acid |