|
CAS#: 88797-20-0 Product: Sodium 2,3,4,5-tetrachlorophenolate No suppilers available for the product. |
| Name | Sodium 2,3,4,5-tetrachlorophenolate |
|---|---|
| Synonyms | 2,3,4,5-Tetrachlorophenol sodium salt; Sodium 2,3,4,5-tetrachlorophenate |
| Molecular Structure | ![]() |
| Molecular Formula | C6HCl4NaO |
| Molecular Weight | 253.87 |
| CAS Registry Number | 88797-20-0 |
| SMILES | [Na+].Clc1c([O-])cc(Cl)c(Cl)c1Cl |
| InChI | 1S/C6H2Cl4O.Na/c7-2-1-3(11)5(9)6(10)4(2)8;/h1,11H;/q;+1/p-1 |
| InChIKey | YBXNXQNSYXJDAZ-UHFFFAOYSA-M |
| Boiling point | 289.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 128.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2,3,4,5-tetrachlorophenolate |