|
CAS#: 888968-35-2 Product: 2-[3-(hydroxymethyl)phenyl]sulfanylpyridine-4-carbonitrile No suppilers available for the product. |
| Name | 2-[3-(hydroxymethyl)phenyl]sulfanylpyridine-4-carbonitrile |
|---|---|
| Synonyms | 2-(3-(hydroxymethyl)phenylthio)isonicotinonitrile; 4-PYRIDINECARBONITRILE,2-[[3-(HYDROXYMETHYL)PHENYL]THIO]- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 |
| CAS Registry Number | 888968-35-2 |
| SMILES | c1cc(cc(c1)Sc2cc(ccn2)C#N)CO |
| InChI | 1S/C13H10N2OS/c14-8-10-4-5-15-13(7-10)17-12-3-1-2-11(6-12)9-16/h1-7,16H,9H2 |
| InChIKey | NGVDCAJRRJNDQB-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.099°C at 760 mmHg (Cal.) |
| Flash point | 233.874°C (Cal.) |
| Refractive index | 1.677 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[3-(hydroxymethyl)phenyl]sulfanylpyridine-4-carbonitrile |