Online Database of Chemicals from Around the World
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (650) 278-9963 | |||
 |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Rieke Metals, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (402) 434-2775 | |||
|
sales@riekemetals.com | |||
| Chemical manufacturer | ||||
| Name | 3-[2-(Trifluoromethyl)benzoyl]phenyl acetate |
|---|---|
| Synonyms | 3-Acetoxy-2'-trifluorobenzophenone |
| Molecular Structure | ![CAS#: 890099-39-5, 3-[2-(Trifluoromethyl)benzoyl]phenyl acetate](/moreStructures/890099-39-5.gif) |
| Molecular Formula | C16H11F3O3 |
| Molecular Weight | 308.25 |
| CAS Registry Number | 890099-39-5 |
| SMILES | O=C(C)Oc1cc(ccc1)C(=O)c2ccccc2C(F)(F)F |
| InChI | 1S/C16H11F3O3/c1-10(20)22-12-6-4-5-11(9-12)15(21)13-7-2-3-8-14(13)16(17,18)19/h2-9H,1H3 |
| InChIKey | GAKZLDXGBORGII-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.51°C at 760 mmHg (Cal.) |
| Flash point | 200.235°C (Cal.) |
| Refractive index | 1.518 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-[2-(Trifluoromethyl)benzoyl]phenyl acetate |