|
CAS#: 89026-15-3 Product: N-Formyl-L-methionyl-2-methylalanyl-L-phenylalanine No suppilers available for the product. |
| Name | N-Formyl-L-methionyl-2-methylalanyl-L-phenylalanine |
|---|---|
| Synonyms | F-Met-aib-phe; L-Phenyla |
| Molecular Structure | ![]() |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.50 |
| CAS Registry Number | 89026-15-3 |
| SMILES | O=CN[C@H](C(=O)NC(C(=O)N[C@H](C(=O)O)Cc1ccccc1)(C)C)CCSC |
| InChI | 1S/C19H27N3O5S/c1-19(2,22-16(24)14(20-12-23)9-10-28-3)18(27)21-15(17(25)26)11-13-7-5-4-6-8-13/h4-8,12,14-15H,9-11H2,1-3H3,(H,20,23)(H,21,27)(H,22,24)(H,25,26)/t14-,15-/m0/s1 |
| InChIKey | JCWFZOZLTFSYIA-GJZGRUSLSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 781.124°C at 760 mmHg (Cal.) |
| Flash point | 426.208°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Formyl-L-methionyl-2-methylalanyl-L-phenylalanine |