|
CAS#: 891197-41-4 Product: 2,4-Diethoxy-7,8,9,10-tetrahydroazepino[2,1-b]quinazolin-12(6H)-one No suppilers available for the product. |
| Name | 2,4-Diethoxy-7,8,9,10-tetrahydroazepino[2,1-b]quinazolin-12(6H)-one |
|---|---|
| Synonyms | AZEPINO[2 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 |
| CAS Registry Number | 891197-41-4 |
| SMILES | O=C1N3/C(=N\c2c1cc(OCC)cc2OCC)CCCCC3 |
| InChI | 1S/C17H22N2O3/c1-3-21-12-10-13-16(14(11-12)22-4-2)18-15-8-6-5-7-9-19(15)17(13)20/h10-11H,3-9H2,1-2H3 |
| InChIKey | MCFSYEWJQOTORP-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.947°C at 760 mmHg (Cal.) |
| Flash point | 246.483°C (Cal.) |
| Refractive index | 1.598 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diethoxy-7,8,9,10-tetrahydroazepino[2,1-b]quinazolin-12(6H)-one |