|
CAS#: 89156-94-5 Product: (2Z)-3-(4-Methoxyphenyl)-2-phenylacrylic acid No suppilers available for the product. |
| Name | (2Z)-3-(4-Methoxyphenyl)-2-phenylacrylic acid |
|---|---|
| Synonyms | (2E)-3-(4-Methoxyphenyl)-2-phenylacrylic acid; 3-(4-methoxyphenyl)-2-phenylacrylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 |
| CAS Registry Number | 89156-94-5 |
| SMILES | O=C(O)C(=C\c1ccc(OC)cc1)/c2ccccc2 |
| InChI | 1S/C16H14O3/c1-19-14-9-7-12(8-10-14)11-15(16(17)18)13-5-3-2-4-6-13/h2-11H,1H3,(H,17,18)/b15-11- |
| InChIKey | NHUQYXSTNXLJIW-PTNGSMBKSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.932°C at 760 mmHg (Cal.) |
| Flash point | 141.683°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z)-3-(4-Methoxyphenyl)-2-phenylacrylic acid |