|
CAS#: 892-17-1 Product: 15,16-Dihydro-11-Methylcyclopenta(a)Phenanthren-17-One No suppilers available for the product. |
| Name | 15,16-Dihydro-11-Methylcyclopenta(a)Phenanthren-17-One |
|---|---|
| Synonyms | Brn 2280058; Ccris 972; 11-Methyl-15,16-Dihydro-17-Oxocyclopenta(A)Phenanthrene |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14O |
| Molecular Weight | 246.31 |
| CAS Registry Number | 892-17-1 |
| SMILES | C1=CC3=C(C2=C1C=CC=C2)C(=CC4=C3CCC4=O)C |
| InChI | 1S/C18H14O/c1-11-10-16-14(8-9-17(16)19)15-7-6-12-4-2-3-5-13(12)18(11)15/h2-7,10H,8-9H2,1H3 |
| InChIKey | SKCVVXWCDKAJTI-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.384°C at 760 mmHg (Cal.) |
| Flash point | 211.291°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 15,16-Dihydro-11-Methylcyclopenta(a)Phenanthren-17-One |