Online Database of Chemicals from Around the World
|
CAS#: 89210-68-4 Product: 4-{[(3beta,8xi,9xi,14xi)-3-Hydroxycholest-5-en-4-yl]amino}butanoic acid No suppilers available for the product. |
| Name | 4-{[(3beta,8xi,9xi,14xi)-3-Hydroxycholest-5-en-4-yl]amino}butanoic acid |
|---|---|
| Synonyms | Cholest-5-en-3-ol (3β)-, 4-aminobutanoate; Cholesteryl GABA |
| Molecular Structure | ![CAS#: 89210-68-4, 4-{[(3beta,8xi,9xi,14xi)-3-Hydroxycholest-5-en-4-yl]amino}butanoic acid](/moreStructures/89210-68-4.gif) |
| Molecular Formula | C31H53NO3 |
| Molecular Weight | 487.76 |
| CAS Registry Number | 89210-68-4 |
| SMILES | O=C(O)CCCNC4C\3=C\CC1C(CC[C@]2(C1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]/3(C)CC[C@@H]4O |
| InChI | 1S/C31H53NO3/c1-20(2)8-6-9-21(3)23-13-14-24-22-11-12-26-29(32-19-7-10-28(34)35)27(33)16-18-31(26,5)25(22)15-17-30(23,24)4/h12,20-25,27,29,32-33H,6-11,13-19H2,1-5H3,(H,34,35)/t21-,22?,23-,24?,25?,27+,29?,30-,31-/m1/s1 |
| InChIKey | XKAKGVWSPKWVGH-RLXQBPMMSA-N |
| Density | 1.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 616.647°C at 760 mmHg (Cal.) |
| Flash point | 326.737°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-{[(3beta,8xi,9xi,14xi)-3-Hydroxycholest-5-en-4-yl]amino}butanoic acid |