|
CAS#: 89223-80-3 Product: 4-[4-(Diphenylmethyl)-1-piperazinyl]-1-(4-fluorophenyl)-1-butanone No suppilers available for the product. |
| Name | 4-[4-(Diphenylmethyl)-1-piperazinyl]-1-(4-fluorophenyl)-1-butanone |
|---|---|
| Synonyms | 1-Butanon |
| Molecular Structure | ![]() |
| Molecular Formula | C27H29FN2O |
| Molecular Weight | 416.53 |
| CAS Registry Number | 89223-80-3 |
| SMILES | Fc1ccc(cc1)C(=O)CCCN4CCN(C(c2ccccc2)c3ccccc3)CC4 |
| InChI | 1S/C27H29FN2O/c28-25-15-13-22(14-16-25)26(31)12-7-17-29-18-20-30(21-19-29)27(23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-6,8-11,13-16,27H,7,12,17-21H2 |
| InChIKey | BNUWAVBVXCLUJD-UHFFFAOYSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 550.689°C at 760 mmHg (Cal.) |
| Flash point | 286.847°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[4-(Diphenylmethyl)-1-piperazinyl]-1-(4-fluorophenyl)-1-butanone |