Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BioBlocks Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (858) 558-5900 | |||
|
sales@bioblocks.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl 2,7-dimethyl-3-quinolinecarboxylate |
|---|---|
| Synonyms | 2,7-Dimethyl quinoline-3-carboxylic acid ethyl ester |
| Molecular Structure |  |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.27 |
| CAS Registry Number | 892874-65-6 |
| SMILES | CCOC(=O)c1cc2ccc(C)cc2nc1C |
| InChI | 1S/C14H15NO2/c1-4-17-14(16)12-8-11-6-5-9(2)7-13(11)15-10(12)3/h5-8H,4H2,1-3H3 |
| InChIKey | XECUIRQNZBISJF-UHFFFAOYSA-N |
| Density | 1.125g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.665°C at 760 mmHg (Cal.) |
| Flash point | 151.967°C (Cal.) |
| Refractive index | 1.584 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ethyl 2,7-dimethyl-3-quinolinecarboxylate |