|
CAS#: 89321-96-0 Product: (3R,5Z,7E,11alpha)-9,10-Secocholesta-5,7,10-triene-3,11-diol No suppilers available for the product. |
| Name | (3R,5Z,7E,11alpha)-9,10-Secocholesta-5,7,10-triene-3,11-diol |
|---|---|
| Synonyms | 11-Hydroxyvitamin D3; 11α-Hydroxyvitamin D3 |
| Molecular Structure | ![]() |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.64 |
| CAS Registry Number | 89321-96-0 |
| SMILES | O[C@H]1CC(\C(=C)CC1)=C\C=C2/C[C@H](O)C[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C |
| InChI | 1S/C27H44O2/c1-18(2)7-6-8-20(4)25-13-14-26-22(16-24(29)17-27(25,26)5)11-10-21-15-23(28)12-9-19(21)3/h10-11,18,20,23-26,28-29H,3,6-9,12-17H2,1-2,4-5H3/b21-10-,22-11+/t20-,23-,24+,25-,26+,27-/m1/s1 |
| InChIKey | KDPWFHILYNISTF-DQCVJNKXSA-N |
| Density | 1.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.183°C at 760 mmHg (Cal.) |
| Flash point | 221.919°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R,5Z,7E,11alpha)-9,10-Secocholesta-5,7,10-triene-3,11-diol |