Online Database of Chemicals from Around the World
|
CAS#: 89368-92-3 Product: 7,7'-Dimethoxy-3,3'-dimethyl-8,8'-bis(3-methyl-2-buten-1-yl)-9H,9'H-2,2'-bicarbazole-1,1'-diol No suppilers available for the product. |
| Name | 7,7'-Dimethoxy-3,3'-dimethyl-8,8'-bis(3-methyl-2-buten-1-yl)-9H,9'H-2,2'-bicarbazole-1,1'-diol |
|---|---|
| Synonyms | BISMURRAYAFOLINE B; NCI60_018843 |
| Molecular Structure |  |
| Molecular Formula | C38H40N2O4 |
| Molecular Weight | 588.74 |
| CAS Registry Number | 89368-92-3 |
| SMILES | CC1=CC2=C(C(=C1C3=C(C4=C(C=C3C)C5=C(N4)C(=C(C=C5)OC)CC=C(C)C)O)O)NC6=C2C=CC(=C6CC=C(C)C)OC |
| InChI | 1S/C38H40N2O4/c1-19(2)9-11-25-29(43-7)15-13-23-27-17-21(5)31(37(41)35(27)39-33(23)25)32-22(6)18-28-24-14-16-30(44-8)26(12-10-20(3)4)34(24)40-36(28)38(32)42/h9-10,13-18,39-42H,11-12H2,1-8H3 |
| InChIKey | STVAUJYOJBWBNS-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 781.5±55.0°C at 760 mmHg (Cal.) |
| Flash point | 426.4±31.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,7'-Dimethoxy-3,3'-dimethyl-8,8'-bis(3-methyl-2-buten-1-yl)-9H,9'H-2,2'-bicarbazole-1,1'-diol |