|
CAS#: 894074-71-6 Product: 4-(4-Cyanophenyl)-5-ethyl-2-methyl-1H-pyrrole-3-carboxylic acid No suppilers available for the product. |
| Name | 4-(4-Cyanophenyl)-5-ethyl-2-methyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| Synonyms | 1H-PYRROL |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.28 |
| CAS Registry Number | 894074-71-6 |
| SMILES | CCc1c(c(c([nH]1)C)C(=O)O)c2ccc(cc2)C#N |
| InChI | 1S/C15H14N2O2/c1-3-12-14(13(15(18)19)9(2)17-12)11-6-4-10(8-16)5-7-11/h4-7,17H,3H2,1-2H3,(H,18,19) |
| InChIKey | DROCZWURXKYKPR-UHFFFAOYSA-N |
| Density | 1.281g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.259°C at 760 mmHg (Cal.) |
| Flash point | 232.761°C (Cal.) |
| Refractive index | 1.624 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Cyanophenyl)-5-ethyl-2-methyl-1H-pyrrole-3-carboxylic acid |