|
CAS#: 89458-63-9 Product: 2,5-Furandione - 7,12-dioxaspiro[5.6]dodeca-8,10-diene (1:1) No suppilers available for the product. |
| Name | 2,5-Furandione - 7,12-dioxaspiro[5.6]dodeca-8,10-diene (1:1) |
|---|---|
| Synonyms | Cda-MA |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.27 |
| CAS Registry Number | 89458-63-9 |
| SMILES | O=C\1OC(=O)/C=C/1.O1/C=C\C=C/OC12CCCCC2 |
| InChI | 1S/C10H14O2.C4H2O3/c1-2-6-10(7-3-1)11-8-4-5-9-12-10;5-3-1-2-4(6)7-3/h4-5,8-9H,1-3,6-7H2;1-2H |
| InChIKey | WAKXAHCLSHRPIF-UHFFFAOYSA-N |
| Boiling point | 256.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 101.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Furandione - 7,12-dioxaspiro[5.6]dodeca-8,10-diene (1:1) |