|
CAS#: 89550-93-6 Product: 8-Sulfanylcyclohepta[c][1,2]oxathiole-3,4-dione No suppilers available for the product. |
| Name | 8-Sulfanylcyclohepta[c][1,2]oxathiole-3,4-dione |
|---|---|
| Synonyms | 4-Hydroxy-8-thioxocyclohept(c)-1,2-oxathiol-3(8H)-one; Cyclohept(c)(1,2)oxathiol-3(8H)-one, 4-hydroxy-8-thioxo- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4O3S2 |
| Molecular Weight | 212.25 |
| CAS Registry Number | 89550-93-6 |
| SMILES | O=C1/C=C\C=C(\S)/C=2SOC(=O)C1=2 |
| InChI | 1S/C8H4O3S2/c9-4-2-1-3-5(12)7-6(4)8(10)11-13-7/h1-3,12H |
| InChIKey | RWJXTYSZCDAMCD-UHFFFAOYSA-N |
| Density | 1.607g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.524°C at 760 mmHg (Cal.) |
| Flash point | 166.396°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Sulfanylcyclohepta[c][1,2]oxathiole-3,4-dione |