Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 6,7-Dihydroxy-3-(4-Methoxyphenyl)-4H-1-Benzopyran-4-One |
|---|---|
| Synonyms | 6,7-Dihydroxy-3-(4-Methoxyphenyl)-4-Chromenone; 6,7-Dihydroxy-3-(4-Methoxyphenyl)Chromone; C10536 |
| Molecular Structure |  |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 |
| CAS Registry Number | 897-46-1 |
| EINECS | 212-980-9 |
| SMILES | C1=C(O)C(=CC2=C1C(C(=CO2)C3=CC=C(OC)C=C3)=O)O |
| InChI | 1S/C16H12O5/c1-20-10-4-2-9(3-5-10)12-8-21-15-7-14(18)13(17)6-11(15)16(12)19/h2-8,17-18H,1H3 |
| InChIKey | GCWOYVFHJDNKIN-UHFFFAOYSA-N |
| Density | 1.42g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.013°C at 760 mmHg (Cal.) |
| Flash point | 209.497°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dihydroxy-3-(4-Methoxyphenyl)-4H-1-Benzopyran-4-One |