|
CAS#: 89710-82-7 Product: 4-[2-Hydroxy-3-(isopropylamino)propoxy]-1,2-naphthalenediol No suppilers available for the product. |
| Name | 4-[2-Hydroxy-3-(isopropylamino)propoxy]-1,2-naphthalenediol |
|---|---|
| Synonyms | 3,4-Dihydroxypropranolol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.34 |
| CAS Registry Number | 89710-82-7 |
| SMILES | OC(CNC(C)C)COc2c1ccccc1c(O)c(O)c2 |
| InChI | 1S/C16H21NO4/c1-10(2)17-8-11(18)9-21-15-7-14(19)16(20)13-6-4-3-5-12(13)15/h3-7,10-11,17-20H,8-9H2,1-2H3 |
| InChIKey | NQLMMVJNBRHISU-UHFFFAOYSA-N |
| Density | 1.245g/cm3 (Cal.) |
|---|---|
| Boiling point | 542.01°C at 760 mmHg (Cal.) |
| Flash point | 281.598°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[2-Hydroxy-3-(isopropylamino)propoxy]-1,2-naphthalenediol |