|
CAS#: 898044-49-0 Product: 4-Chloro-2-quinazolinecarbonitrile No suppilers available for the product. |
| Name | 4-Chloro-2-quinazolinecarbonitrile |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H4ClN3 |
| Molecular Weight | 189.60 |
| CAS Registry Number | 898044-49-0 |
| SMILES | c1ccc2c(c1)c(nc(n2)C#N)Cl |
| InChI | 1S/C9H4ClN3/c10-9-6-3-1-2-4-7(6)12-8(5-11)13-9/h1-4H |
| InChIKey | STHFFVMWNKRMAQ-UHFFFAOYSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.621°C at 760 mmHg (Cal.) |
| Flash point | 187.017°C (Cal.) |
| Refractive index | 1.675 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2-quinazolinecarbonitrile |