|
CAS#: 899-39-8 Product: 17b-Hydroxy-5a-Androstane-3,6-Dione No suppilers available for the product. |
| Name | 17b-Hydroxy-5a-Androstane-3,6-Dione |
|---|---|
| Synonyms | (5S,8R,9S,10R,13S,14S,17S)-17-Hydroxy-10,13-Dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthrene-3,6-Quinone; C15416; Zinc04104753 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 |
| CAS Registry Number | 899-39-8 |
| SMILES | [C@H]4([C@]3(C)[C@H]([C@@H]2CC([C@H]1CC(=O)CC[C@@]1([C@H]2CC3)C)=O)CC4)O |
| InChI | 1S/C19H28O3/c1-18-7-5-11(20)9-15(18)16(21)10-12-13-3-4-17(22)19(13,2)8-6-14(12)18/h12-15,17,22H,3-10H2,1-2H3/t12-,13-,14-,15+,17-,18+,19-/m0/s1 |
| InChIKey | SOQWQZZNPGBTQR-YDOJUKJESA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.413°C at 760 mmHg (Cal.) |
| Flash point | 242.142°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17b-Hydroxy-5a-Androstane-3,6-Dione |